About 2-nonylpyran-3,4-dione
2-nonylpyran-3,4-dione (PubChem CID 21397304) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-nonylpyran-3,4-dione.
Molecular Properties
| Compound Name | 2-nonylpyran-3,4-dione |
| PubChem CID | 21397304 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-nonylpyran-3,4-dione |
| SMILES | CCCCCCCCCC1OC=CC(=O)C1=O |
| InChI | InChI=1S/C14H22O3/c1-2-3-4-5-6-7-8-9-13-14(16)12(15)10-11-17-13/h10-11,13H,2-9H2,1H3 |
| InChIKey | ANWFAPWCGSNIDS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-nonylpyran-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonylpyran-3,4-dione?
The IUPAC name of 2-nonylpyran-3,4-dione (CID 21397304) is 2-nonylpyran-3,4-dione.
What is the SMILES notation for 2-nonylpyran-3,4-dione?
The canonical SMILES for 2-nonylpyran-3,4-dione is CCCCCCCCCC1OC=CC(=O)C1=O.
What is the InChIKey of 2-nonylpyran-3,4-dione?
The InChIKey is ANWFAPWCGSNIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-2-3-4-5-6-7-8-9-13-14(16)12(15)10-11-17-13/h10-11,13H,2-9H2,1H3.
What are the key properties of 2-nonylpyran-3,4-dione?
2-nonylpyran-3,4-dione has a molecular weight of 238.33 g/mol, XLogP of 3.18, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonylpyran-3,4-dione is sourced from PubChem (CID 21397304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).