About 2-Propan-2-ylpyran-3,4-dione
2-Propan-2-ylpyran-3,4-dione (PubChem CID 21397330) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-propan-2-ylpyran-3,4-dione.
Molecular Properties
| Compound Name | 2-Propan-2-ylpyran-3,4-dione |
| PubChem CID | 21397330 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-propan-2-ylpyran-3,4-dione |
| SMILES | CC(C)C1C(=O)C(=O)C=CO1 |
| InChI | InChI=1S/C8H10O3/c1-5(2)8-7(10)6(9)3-4-11-8/h3-5,8H,1-2H3 |
| InChIKey | NXBFFUQVPHWIJY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 215 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-Propan-2-ylpyran-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Propan-2-ylpyran-3,4-dione?
The IUPAC name of 2-Propan-2-ylpyran-3,4-dione (CID 21397330) is 2-propan-2-ylpyran-3,4-dione.
What is the SMILES notation for 2-Propan-2-ylpyran-3,4-dione?
The canonical SMILES for 2-Propan-2-ylpyran-3,4-dione is CC(C)C1C(=O)C(=O)C=CO1.
What is the InChIKey of 2-Propan-2-ylpyran-3,4-dione?
The InChIKey is NXBFFUQVPHWIJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-5(2)8-7(10)6(9)3-4-11-8/h3-5,8H,1-2H3.
What are the key properties of 2-Propan-2-ylpyran-3,4-dione?
2-Propan-2-ylpyran-3,4-dione has a molecular weight of 154.16 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Propan-2-ylpyran-3,4-dione is sourced from PubChem (CID 21397330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).