C20H35F3O4 — CID 21397415
8-acetyl-17,17,17-trifluoro-12-hydroxy-8-methylheptadecanoic acid (PubChem CID 21397415) has the molecular formula C20H35F3O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 8-acetyl-17,17,17-trifluoro-12-hydroxy-8-methylheptadecanoic acid.
| Compound Name | 8-acetyl-17,17,17-trifluoro-12-hydroxy-8-methylheptadecanoic acid |
|---|---|
| PubChem CID | 21397415 |
| Molecular Formula | C20H35F3O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 8-acetyl-17,17,17-trifluoro-12-hydroxy-8-methylheptadecanoic acid |
| SMILES | CC(=O)C(C)(CCCCCCC(=O)O)CCCC(O)CCCCC(F)(F)F |
| InChI | InChI=1S/C20H35F3O4/c1-16(24)19(2,13-7-4-3-5-12-18(26)27)14-9-11-17(25)10-6-8-15-20(21,22)23/h17,25H,3-15H2,1-2H3,(H,26,27) |
| InChIKey | IXZFAQUVDBYHHB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|