C8H10F6O — CID 21397503
2,4-diethyl-2,3,3,4,5,5-hexafluorooxolane (PubChem CID 21397503) has the molecular formula C8H10F6O and a molecular weight of 236.15 g/mol. Its IUPAC name is 2,4-diethyl-2,3,3,4,5,5-hexafluorooxolane.
| Compound Name | 2,4-diethyl-2,3,3,4,5,5-hexafluorooxolane |
|---|---|
| PubChem CID | 21397503 |
| Molecular Formula | C8H10F6O |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2,4-diethyl-2,3,3,4,5,5-hexafluorooxolane |
| SMILES | CCC1(F)OC(F)(F)C(F)(CC)C1(F)F |
| InChI | InChI=1S/C8H10F6O/c1-3-5(9)7(11,12)6(10,4-2)15-8(5,13)14/h3-4H2,1-2H3 |
| InChIKey | QCONWJRHIVYWJV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |