About (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid
(NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid (PubChem CID 21397747) has the molecular formula C9H15Cl2NO3
and a molecular weight of 256.13 g/mol. Its IUPAC name is (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid.
Molecular Properties
| Compound Name | (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid |
| PubChem CID | 21397747 |
| Molecular Formula | C9H15Cl2NO3 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid |
| SMILES | O/N=C1/CCCCC1Cl.O=C(O)CCCl |
| InChI | InChI=1S/C6H10ClNO.C3H5ClO2/c7-5-3-1-2-4-6(5)8-9;4-2-1-3(5)6/h5,9H,1-4H2;1-2H2,(H,5,6)/b8-6-; |
| InChIKey | BPUWWNCWZAASOH-PHZXCRFESA-N |
| XLogP | 2.70 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid?
The IUPAC name of (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid (CID 21397747) is (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid.
What is the SMILES notation for (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid?
The canonical SMILES for (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid is O/N=C1/CCCCC1Cl.O=C(O)CCCl.
What is the InChIKey of (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid?
The InChIKey is BPUWWNCWZAASOH-PHZXCRFESA-N. The full InChI is InChI=1S/C6H10ClNO.C3H5ClO2/c7-5-3-1-2-4-6(5)8-9;4-2-1-3(5)6/h5,9H,1-4H2;1-2H2,(H,5,6)/b8-6-;.
What are the key properties of (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid?
(NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid has a molecular weight of 256.13 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(2-chlorocyclohexylidene)hydroxylamine;3-chloropropanoic acid is sourced from PubChem (CID 21397747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).