C9H9N5O2 — CID 21397871
2-[5-(methylamino)tetrazol-1-yl]benzoic acid (PubChem CID 21397871) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[5-(methylamino)tetrazol-1-yl]benzoic acid.
| Compound Name | 2-[5-(methylamino)tetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 21397871 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-[5-(methylamino)tetrazol-1-yl]benzoic acid |
| SMILES | CNc1nnnn1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C9H9N5O2/c1-10-9-11-12-13-14(9)7-5-3-2-4-6(7)8(15)16/h2-5H,1H3,(H,15,16)(H,10,11,13) |
| InChIKey | HADZXXKJUMNBSB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |