About 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one
1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one (PubChem CID 21398427) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one.
Molecular Properties
| Compound Name | 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one |
| PubChem CID | 21398427 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one |
| SMILES | CN1CCN2C(=O)c3ccccc3C12C |
| InChI | InChI=1S/C12H14N2O/c1-12-10-6-4-3-5-9(10)11(15)14(12)8-7-13(12)2/h3-6H,7-8H2,1-2H3 |
| InChIKey | YWGUREHCYTWZLO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
The IUPAC name of 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one (CID 21398427) is 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one.
What is the SMILES notation for 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
The canonical SMILES for 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one is CN1CCN2C(=O)c3ccccc3C12C.
What is the InChIKey of 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
The InChIKey is YWGUREHCYTWZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-12-10-6-4-3-5-9(10)11(15)14(12)8-7-13(12)2/h3-6H,7-8H2,1-2H3.
What are the key properties of 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one has a molecular weight of 202.26 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9b-dimethyl-2,3-dihydroimidazo[2,1-a]isoindol-5-one is sourced from PubChem (CID 21398427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).