C13H10Cl2F4N2O3 — CID 21398898
6-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-3-ethyl-1H-quinazoline-2,4-dione (PubChem CID 21398898) has the molecular formula C13H10Cl2F4N2O3 and a molecular weight of 389.13 g/mol. Its IUPAC name is 6-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-3-ethyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-3-ethyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 21398898 |
| Molecular Formula | C13H10Cl2F4N2O3 |
| Molecular Weight | 389.13 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 6-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-3-ethyl-1H-quinazoline-2,4-dione |
| SMILES | CCn1c(=O)[nH]c2ccc(C(O)(C(F)(F)Cl)C(F)(F)Cl)cc2c1=O |
| InChI | InChI=1S/C13H10Cl2F4N2O3/c1-2-21-9(22)7-5-6(3-4-8(7)20-10(21)23)11(24,12(14,16)17)13(15,18)19/h3-5,24H,2H2,1H3,(H,20,23) |
| InChIKey | MXKPRMUPYPPNON-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|