About 2-methylpropylcyanamide
2-methylpropylcyanamide (PubChem CID 21399032) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 2-methylpropylcyanamide.
Molecular Properties
| Compound Name | 2-methylpropylcyanamide |
| PubChem CID | 21399032 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2-methylpropylcyanamide |
| SMILES | CC(C)CNC#N |
| InChI | InChI=1S/C5H10N2/c1-5(2)3-7-4-6/h5,7H,3H2,1-2H3 |
| InChIKey | OMGNVIJEQKWIHI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylcyanamide?
The IUPAC name of 2-methylpropylcyanamide (CID 21399032) is 2-methylpropylcyanamide.
What is the SMILES notation for 2-methylpropylcyanamide?
The canonical SMILES for 2-methylpropylcyanamide is CC(C)CNC#N.
What is the InChIKey of 2-methylpropylcyanamide?
The InChIKey is OMGNVIJEQKWIHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-5(2)3-7-4-6/h5,7H,3H2,1-2H3.
What are the key properties of 2-methylpropylcyanamide?
2-methylpropylcyanamide has a molecular weight of 98.15 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylcyanamide is sourced from PubChem (CID 21399032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).