About S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate
S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate (PubChem CID 21399145) has the molecular formula C19H32O2S
and a molecular weight of 324.53 g/mol. Its IUPAC name is S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate.
Molecular Properties
| Compound Name | S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate |
| PubChem CID | 21399145 |
| Molecular Formula | C19H32O2S |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate |
| SMILES | CCSC(=O)/C=C1/C=C(CC(C)CCCC(C)(C)OC)CC1 |
| InChI | InChI=1S/C19H32O2S/c1-6-22-18(20)14-17-10-9-16(13-17)12-15(2)8-7-11-19(3,4)21-5/h13-15H,6-12H2,1-5H3/b17-14+ |
| InChIKey | NWYRFADSRXDRCY-SAPNQHFASA-N |
| XLogP | 5.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate?
The IUPAC name of S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate (CID 21399145) is S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate.
What is the SMILES notation for S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate?
The canonical SMILES for S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate is CCSC(=O)/C=C1/C=C(CC(C)CCCC(C)(C)OC)CC1.
What is the InChIKey of S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate?
The InChIKey is NWYRFADSRXDRCY-SAPNQHFASA-N. The full InChI is InChI=1S/C19H32O2S/c1-6-22-18(20)14-17-10-9-16(13-17)12-15(2)8-7-11-19(3,4)21-5/h13-15H,6-12H2,1-5H3/b17-14+.
What are the key properties of S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate?
S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate has a molecular weight of 324.53 g/mol, XLogP of 5.53, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (2E)-2-[3-(6-methoxy-2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]ethanethioate is sourced from PubChem (CID 21399145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).