About ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate
ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate (PubChem CID 21399155) has the molecular formula C20H36O3
and a molecular weight of 324.51 g/mol. Its IUPAC name is ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate |
| PubChem CID | 21399155 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)CC1(O)C=C(CC(C)CCCC(C)(C)CC)CC1 |
| InChI | InChI=1S/C20H36O3/c1-6-19(4,5)11-8-9-16(3)13-17-10-12-20(22,14-17)15-18(21)23-7-2/h14,16,22H,6-13,15H2,1-5H3 |
| InChIKey | FKXBSIWWLGHPRG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate?
The IUPAC name of ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate (CID 21399155) is ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate.
What is the SMILES notation for ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate?
The canonical SMILES for ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate is CCOC(=O)CC1(O)C=C(CC(C)CCCC(C)(C)CC)CC1.
What is the InChIKey of ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate?
The InChIKey is FKXBSIWWLGHPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O3/c1-6-19(4,5)11-8-9-16(3)13-17-10-12-20(22,14-17)15-18(21)23-7-2/h14,16,22H,6-13,15H2,1-5H3.
What are the key properties of ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate?
ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate has a molecular weight of 324.51 g/mol, XLogP of 5.02, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate is sourced from PubChem (CID 21399155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).