C20H36O3 — CID 21399155
ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate (PubChem CID 21399155) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 21399155 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | ethyl 2-[1-hydroxy-3-(2,6,6-trimethyloctyl)cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)CC1(O)C=C(CC(C)CCCC(C)(C)CC)CC1 |
| InChI | InChI=1S/C20H36O3/c1-6-19(4,5)11-8-9-16(3)13-17-10-12-20(22,14-17)15-18(21)23-7-2/h14,16,22H,6-13,15H2,1-5H3 |
| InChIKey | FKXBSIWWLGHPRG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|