About 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine
1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine (PubChem CID 21399240) has the molecular formula C23H44N2
and a molecular weight of 348.62 g/mol. Its IUPAC name is 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine.
Molecular Properties
| Compound Name | 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine |
| PubChem CID | 21399240 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C23H44N2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-22-20-24(2)21-23-25/h7-8,10-11H,3-6,9,12-23H2,1-2H3/b8-7+,11-10+ |
| InChIKey | HZFCDEOAOQJXEB-ZDVGBALWSA-N |
| XLogP | 6.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine?
The IUPAC name of 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine (CID 21399240) is 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine.
What is the SMILES notation for 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine?
The canonical SMILES for 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine is CCCCC/C=C/C/C=C/CCCCCCCCN1CCN(C)CC1.
What is the InChIKey of 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine?
The InChIKey is HZFCDEOAOQJXEB-ZDVGBALWSA-N. The full InChI is InChI=1S/C23H44N2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-22-20-24(2)21-23-25/h7-8,10-11H,3-6,9,12-23H2,1-2H3/b8-7+,11-10+.
What are the key properties of 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine?
1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine has a molecular weight of 348.62 g/mol, XLogP of 6.05, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(9E,12E)-octadeca-9,12-dienyl]piperazine is sourced from PubChem (CID 21399240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).