About bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+)
bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) (PubChem CID 21399652) has the molecular formula C18H24MoN2
and a molecular weight of 364.34 g/mol. Its IUPAC name is bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+).
Molecular Properties
| Compound Name | bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) |
| PubChem CID | 21399652 |
| Molecular Formula | C18H24MoN2 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) |
| SMILES | [CH2-]c1ccccc1N(C)C.[CH2-]c1ccccc1N(C)C.[Mo+2] |
| InChI | InChI=1S/2C9H12N.Mo/c2*1-8-6-4-5-7-9(8)10(2)3;/h2*4-7H,1H2,2-3H3;/q2*-1;+2 |
| InChIKey | BGXCPQDCGTXCOB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+)?
The IUPAC name of bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) (CID 21399652) is bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+).
What is the SMILES notation for bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+)?
The canonical SMILES for bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) is [CH2-]c1ccccc1N(C)C.[CH2-]c1ccccc1N(C)C.[Mo+2].
What is the InChIKey of bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+)?
The InChIKey is BGXCPQDCGTXCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12N.Mo/c2*1-8-6-4-5-7-9(8)10(2)3;/h2*4-7H,1H2,2-3H3;/q2*-1;+2.
What are the key properties of bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+)?
bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) has a molecular weight of 364.34 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methanidyl-N,N-dimethylaniline);molybdenum(2+) is sourced from PubChem (CID 21399652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).