C18H24CrN2 — CID 21399664
chromium(2+);bis(N,N-dimethyl-1-phenylmethanamine) (PubChem CID 21399664) has the molecular formula C18H24CrN2 and a molecular weight of 320.40 g/mol. Its IUPAC name is chromium(2+);bis(N,N-dimethyl-1-phenylmethanamine).
| Compound Name | chromium(2+);bis(N,N-dimethyl-1-phenylmethanamine) |
|---|---|
| PubChem CID | 21399664 |
| Molecular Formula | C18H24CrN2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | chromium(2+);bis(N,N-dimethyl-1-phenylmethanamine) |
| SMILES | CN(C)Cc1[c-]cccc1.CN(C)Cc1[c-]cccc1.[Cr+2] |
| InChI | InChI=1S/2C9H12N.Cr/c2*1-10(2)8-9-6-4-3-5-7-9;/h2*3-6H,8H2,1-2H3;/q2*-1;+2 |
| InChIKey | ZUCHSKQYPGJTDI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|