About 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione
2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 21399718) has the molecular formula C12H13NO6
and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 21399718 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)Cc1ccc(O)cc1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H8O3.C4H5NO3/c9-7-3-1-6(2-4-7)5-8(10)11;6-3-1-2-4(7)5(3)8/h1-4,9H,5H2,(H,10,11);8H,1-2H2 |
| InChIKey | MNNSHEFJHCPZHW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
The IUPAC name of 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione (CID 21399718) is 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione is O=C(O)Cc1ccc(O)cc1.O=C1CCC(=O)N1O.
What is the InChIKey of 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
The InChIKey is MNNSHEFJHCPZHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C4H5NO3/c9-7-3-1-6(2-4-7)5-8(10)11;6-3-1-2-4(7)5(3)8/h1-4,9H,5H2,(H,10,11);8H,1-2H2.
What are the key properties of 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione has a molecular weight of 267.24 g/mol, XLogP of 0.54, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)acetic acid;1-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 21399718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).