About dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate
dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate (PubChem CID 21400003) has the molecular formula C13H8N2O4
and a molecular weight of 256.22 g/mol. Its IUPAC name is dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate |
| PubChem CID | 21400003 |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate |
| SMILES | C=CCc1c(C(=O)OC#N)cccc1C(=O)OC#N |
| InChI | InChI=1S/C13H8N2O4/c1-2-4-9-10(12(16)18-7-14)5-3-6-11(9)13(17)19-8-15/h2-3,5-6H,1,4H2 |
| InChIKey | XONLFTMFYIPEIX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate?
The IUPAC name of dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate (CID 21400003) is dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate.
What is the SMILES notation for dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate?
The canonical SMILES for dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate is C=CCc1c(C(=O)OC#N)cccc1C(=O)OC#N.
What is the InChIKey of dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate?
The InChIKey is XONLFTMFYIPEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O4/c1-2-4-9-10(12(16)18-7-14)5-3-6-11(9)13(17)19-8-15/h2-3,5-6H,1,4H2.
What are the key properties of dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate?
dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate has a molecular weight of 256.22 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dicyano 2-prop-2-enylbenzene-1,3-dicarboxylate is sourced from PubChem (CID 21400003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).