C15H24N4O3S — CID 21400095
1-[(E)-hex-4-enyl]-4-hydroxy-3-(5-propoxy-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one (PubChem CID 21400095) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[(E)-hex-4-enyl]-4-hydroxy-3-(5-propoxy-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one.
| Compound Name | 1-[(E)-hex-4-enyl]-4-hydroxy-3-(5-propoxy-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 21400095 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(E)-hex-4-enyl]-4-hydroxy-3-(5-propoxy-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one |
| SMILES | C/C=C/CCCN1CCC(O)N(c2nnc(OCCC)s2)C1=O |
| InChI | InChI=1S/C15H24N4O3S/c1-3-5-6-7-9-18-10-8-12(20)19(15(18)21)13-16-17-14(23-13)22-11-4-2/h3,5,12,20H,4,6-11H2,1-2H3/b5-3+ |
| InChIKey | RMGBVBYJWIIOMJ-HWKANZROSA-N |
| XLogP | 2.63 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|