C6H11N3O2S — CID 21400258
1,3,6-trimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione (PubChem CID 21400258) has the molecular formula C6H11N3O2S and a molecular weight of 189.24 g/mol. Its IUPAC name is 1,3,6-trimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3,6-trimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 21400258 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1,3,6-trimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
| SMILES | CN1C(=O)NC(C)(S)N(C)C1=O |
| InChI | InChI=1S/C6H11N3O2S/c1-6(12)7-4(10)8(2)5(11)9(6)3/h12H,1-3H3,(H,7,10) |
| InChIKey | AOFDWTWKAQIDDY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|