C7H13N3O2S — CID 21400267
1-ethyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione (PubChem CID 21400267) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 1-ethyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-ethyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 21400267 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1-ethyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
| SMILES | CCN1C(=O)N(C)C(=O)NC1(C)S |
| InChI | InChI=1S/C7H13N3O2S/c1-4-10-6(12)9(3)5(11)8-7(10,2)13/h13H,4H2,1-3H3,(H,8,11) |
| InChIKey | BWTLNOZKAKLMHJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|