C8H13N3O3 — CID 21400289
1-tert-butyl-3-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 21400289) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-tert-butyl-3-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21400289 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-tert-butyl-3-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)[nH]c(=O)n(C(C)(C)C)c1=O |
| InChI | InChI=1S/C8H13N3O3/c1-8(2,3)11-6(13)9-5(12)10(4)7(11)14/h1-4H3,(H,9,12,13) |
| InChIKey | YILPGFVYNUKSEF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |