C11H20N4O2S — CID 21400345
3-tert-butyl-6-methylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazinane-2,4-dione (PubChem CID 21400345) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-tert-butyl-6-methylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazinane-2,4-dione.
| Compound Name | 3-tert-butyl-6-methylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 21400345 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-tert-butyl-6-methylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazinane-2,4-dione |
| SMILES | CSC1NC(=O)N(C(C)(C)C)C(=O)N1N=C(C)C |
| InChI | InChI=1S/C11H20N4O2S/c1-7(2)13-15-9(18-6)12-8(16)14(10(15)17)11(3,4)5/h9H,1-6H3,(H,12,16) |
| InChIKey | FXYKYROAIJVTSS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|