About (7-hydroxy-3,7-dimethyloctyl) acetate
(7-hydroxy-3,7-dimethyloctyl) acetate (PubChem CID 21400551) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is (7-hydroxy-3,7-dimethyloctyl) acetate.
Molecular Properties
| Compound Name | (7-hydroxy-3,7-dimethyloctyl) acetate |
| PubChem CID | 21400551 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (7-hydroxy-3,7-dimethyloctyl) acetate |
| SMILES | CC(=O)OCCC(C)CCCC(C)(C)O |
| InChI | InChI=1S/C12H24O3/c1-10(7-9-15-11(2)13)6-5-8-12(3,4)14/h10,14H,5-9H2,1-4H3 |
| InChIKey | PRKMLYMLHITSBB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-hydroxy-3,7-dimethyloctyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-hydroxy-3,7-dimethyloctyl) acetate?
The IUPAC name of (7-hydroxy-3,7-dimethyloctyl) acetate (CID 21400551) is (7-hydroxy-3,7-dimethyloctyl) acetate.
What is the SMILES notation for (7-hydroxy-3,7-dimethyloctyl) acetate?
The canonical SMILES for (7-hydroxy-3,7-dimethyloctyl) acetate is CC(=O)OCCC(C)CCCC(C)(C)O.
What is the InChIKey of (7-hydroxy-3,7-dimethyloctyl) acetate?
The InChIKey is PRKMLYMLHITSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-10(7-9-15-11(2)13)6-5-8-12(3,4)14/h10,14H,5-9H2,1-4H3.
What are the key properties of (7-hydroxy-3,7-dimethyloctyl) acetate?
(7-hydroxy-3,7-dimethyloctyl) acetate has a molecular weight of 216.32 g/mol, XLogP of 2.52, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxy-3,7-dimethyloctyl) acetate is sourced from PubChem (CID 21400551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).