About hexachloropalladium(2-);palladium(2+)
hexachloropalladium(2-);palladium(2+) (PubChem CID 21400822) has the molecular formula Cl6Pd2
and a molecular weight of 425.56 g/mol. Its IUPAC name is hexachloropalladium(2-);palladium(2+).
Molecular Properties
| Compound Name | hexachloropalladium(2-);palladium(2+) |
| PubChem CID | 21400822 |
| Molecular Formula | Cl6Pd2 |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 421.62 |
| IUPAC Name | hexachloropalladium(2-);palladium(2+) |
| SMILES | Cl[Pd-2](Cl)(Cl)(Cl)(Cl)Cl.[Pd+2] |
| InChI | InChI=1S/6ClH.2Pd/h6*1H;;/q;;;;;;+2;+4/p-6 |
| InChIKey | WXLFGVGJQJHIAO-UHFFFAOYSA-H |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hexachloropalladium(2-);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexachloropalladium(2-);palladium(2+)?
The IUPAC name of hexachloropalladium(2-);palladium(2+) (CID 21400822) is hexachloropalladium(2-);palladium(2+).
What is the SMILES notation for hexachloropalladium(2-);palladium(2+)?
The canonical SMILES for hexachloropalladium(2-);palladium(2+) is Cl[Pd-2](Cl)(Cl)(Cl)(Cl)Cl.[Pd+2].
What is the InChIKey of hexachloropalladium(2-);palladium(2+)?
The InChIKey is WXLFGVGJQJHIAO-UHFFFAOYSA-H. The full InChI is InChI=1S/6ClH.2Pd/h6*1H;;/q;;;;;;+2;+4/p-6.
What are the key properties of hexachloropalladium(2-);palladium(2+)?
hexachloropalladium(2-);palladium(2+) has a molecular weight of 425.56 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexachloropalladium(2-);palladium(2+) is sourced from PubChem (CID 21400822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).