C12H13FN4O3 — CID 21400903
1-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-3-(2-fluorophenyl)urea (PubChem CID 21400903) has the molecular formula C12H13FN4O3 and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 21400903 |
| Molecular Formula | C12H13FN4O3 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-3-(2-fluorophenyl)urea |
| SMILES | CN1C(=O)C(NC(=O)Nc2ccccc2F)N(C)C1=O |
| InChI | InChI=1S/C12H13FN4O3/c1-16-9(10(18)17(2)12(16)20)15-11(19)14-8-6-4-3-5-7(8)13/h3-6,9H,1-2H3,(H2,14,15,19) |
| InChIKey | YUTYXALQJWFSGK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|