C22H42N2 — CID 21401056
1-ethyl-4-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-ylidene)-2,2,6,6-tetramethylpiperidine (PubChem CID 21401056) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 1-ethyl-4-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-ylidene)-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-ethyl-4-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-ylidene)-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 21401056 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | 1-ethyl-4-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-ylidene)-2,2,6,6-tetramethylpiperidine |
| SMILES | CCN1C(C)(C)CC(=C2CC(C)(C)N(CC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C22H42N2/c1-11-23-19(3,4)13-17(14-20(23,5)6)18-15-21(7,8)24(12-2)22(9,10)16-18/h11-16H2,1-10H3 |
| InChIKey | ZRTJNGYWBNZHAQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|