About 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline
4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline (PubChem CID 21401138) has the molecular formula C11H15F3N2O5S2
and a molecular weight of 376.38 g/mol. Its IUPAC name is 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline |
| PubChem CID | 21401138 |
| Molecular Formula | C11H15F3N2O5S2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline |
| SMILES | Nc1ccccc1C(F)(F)F.O=S(=O)=NCCCCS(=O)(=O)O |
| InChI | InChI=1S/C7H6F3N.C4H9NO5S2/c8-7(9,10)5-3-1-2-4-6(5)11;6-11(7)5-3-1-2-4-12(8,9)10/h1-4H,11H2;1-4H2,(H,8,9,10) |
| InChIKey | YAUXISYTUDFOLB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline?
The IUPAC name of 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline (CID 21401138) is 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline.
What is the SMILES notation for 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline?
The canonical SMILES for 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline is Nc1ccccc1C(F)(F)F.O=S(=O)=NCCCCS(=O)(=O)O.
What is the InChIKey of 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline?
The InChIKey is YAUXISYTUDFOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N.C4H9NO5S2/c8-7(9,10)5-3-1-2-4-6(5)11;6-11(7)5-3-1-2-4-12(8,9)10/h1-4H,11H2;1-4H2,(H,8,9,10).
What are the key properties of 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline?
4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline has a molecular weight of 376.38 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(sulfonylamino)butane-1-sulfonic acid;2-(trifluoromethyl)aniline is sourced from PubChem (CID 21401138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).