C21H20N2O6 — CID 21401470
4-[[3-[(4-carboxyphenyl)methyl]-2,2-dimethyl-4,5-dioxoimidazolidin-1-yl]methyl]benzoic acid (PubChem CID 21401470) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 4-[[3-[(4-carboxyphenyl)methyl]-2,2-dimethyl-4,5-dioxoimidazolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-[(4-carboxyphenyl)methyl]-2,2-dimethyl-4,5-dioxoimidazolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 21401470 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[[3-[(4-carboxyphenyl)methyl]-2,2-dimethyl-4,5-dioxoimidazolidin-1-yl]methyl]benzoic acid |
| SMILES | CC1(C)N(Cc2ccc(C(=O)O)cc2)C(=O)C(=O)N1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H20N2O6/c1-21(2)22(11-13-3-7-15(8-4-13)19(26)27)17(24)18(25)23(21)12-14-5-9-16(10-6-14)20(28)29/h3-10H,11-12H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | JKPDLRHNKWGUHW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|