C19H25NO9S — CID 21401665
7-[[5-(1,3-benzodioxol-5-yloxy)-4-hydroxypentyl]-sulfoamino]hept-5-ynoic acid (PubChem CID 21401665) has the molecular formula C19H25NO9S and a molecular weight of 443.47 g/mol. Its IUPAC name is 7-[[5-(1,3-benzodioxol-5-yloxy)-4-hydroxypentyl]-sulfoamino]hept-5-ynoic acid.
| Compound Name | 7-[[5-(1,3-benzodioxol-5-yloxy)-4-hydroxypentyl]-sulfoamino]hept-5-ynoic acid |
|---|---|
| PubChem CID | 21401665 |
| Molecular Formula | C19H25NO9S |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 7-[[5-(1,3-benzodioxol-5-yloxy)-4-hydroxypentyl]-sulfoamino]hept-5-ynoic acid |
| SMILES | O=C(O)CCCC#CCN(CCCC(O)COc1ccc2c(c1)OCO2)S(=O)(=O)O |
| InChI | InChI=1S/C19H25NO9S/c21-15(13-27-16-8-9-17-18(12-16)29-14-28-17)6-5-11-20(30(24,25)26)10-4-2-1-3-7-19(22)23/h8-9,12,15,21H,1,3,5-7,10-11,13-14H2,(H,22,23)(H,24,25,26) |
| InChIKey | HFEAEKMHFHPABP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|