About 4-(oxan-2-yloxy)nonanal
4-(oxan-2-yloxy)nonanal (PubChem CID 21401684) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-(oxan-2-yloxy)nonanal.
Molecular Properties
| Compound Name | 4-(oxan-2-yloxy)nonanal |
| PubChem CID | 21401684 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 4-(oxan-2-yloxy)nonanal |
| SMILES | CCCCCC(CCC=O)OC1CCCCO1 |
| InChI | InChI=1S/C14H26O3/c1-2-3-4-8-13(9-7-11-15)17-14-10-5-6-12-16-14/h11,13-14H,2-10,12H2,1H3 |
| InChIKey | KPVHBHPGROIXMX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxan-2-yloxy)nonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxan-2-yloxy)nonanal?
The IUPAC name of 4-(oxan-2-yloxy)nonanal (CID 21401684) is 4-(oxan-2-yloxy)nonanal.
What is the SMILES notation for 4-(oxan-2-yloxy)nonanal?
The canonical SMILES for 4-(oxan-2-yloxy)nonanal is CCCCCC(CCC=O)OC1CCCCO1.
What is the InChIKey of 4-(oxan-2-yloxy)nonanal?
The InChIKey is KPVHBHPGROIXMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-2-3-4-8-13(9-7-11-15)17-14-10-5-6-12-16-14/h11,13-14H,2-10,12H2,1H3.
What are the key properties of 4-(oxan-2-yloxy)nonanal?
4-(oxan-2-yloxy)nonanal has a molecular weight of 242.36 g/mol, XLogP of 3.46, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxan-2-yloxy)nonanal is sourced from PubChem (CID 21401684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).