About ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate
ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate (PubChem CID 21401976) has the molecular formula C21H29O5P
and a molecular weight of 392.43 g/mol. Its IUPAC name is ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate.
Molecular Properties
| Compound Name | ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate |
| PubChem CID | 21401976 |
| Molecular Formula | C21H29O5P |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate |
| SMILES | CCOP(=O)(O)Oc1c(C)cc(CCc2cc(C)c(OC)c(C)c2)cc1C |
| InChI | InChI=1S/C21H29O5P/c1-7-25-27(22,23)26-21-16(4)12-19(13-17(21)5)9-8-18-10-14(2)20(24-6)15(3)11-18/h10-13H,7-9H2,1-6H3,(H,22,23) |
| InChIKey | IKAPDZHQGPANOM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate?
The IUPAC name of ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate (CID 21401976) is ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate.
What is the SMILES notation for ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate?
The canonical SMILES for ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate is CCOP(=O)(O)Oc1c(C)cc(CCc2cc(C)c(OC)c(C)c2)cc1C.
What is the InChIKey of ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate?
The InChIKey is IKAPDZHQGPANOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29O5P/c1-7-25-27(22,23)26-21-16(4)12-19(13-17(21)5)9-8-18-10-14(2)20(24-6)15(3)11-18/h10-13H,7-9H2,1-6H3,(H,22,23).
What are the key properties of ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate?
ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate has a molecular weight of 392.43 g/mol, XLogP of 5.23, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] hydrogen phosphate is sourced from PubChem (CID 21401976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).