C5H8BrN5 — CID 21402743
6-(1-bromoethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 21402743) has the molecular formula C5H8BrN5 and a molecular weight of 218.06 g/mol. Its IUPAC name is 6-(1-bromoethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-bromoethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21402743 |
| Molecular Formula | C5H8BrN5 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 6-(1-bromoethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Br)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C5H8BrN5/c1-2(6)3-9-4(7)11-5(8)10-3/h2H,1H3,(H4,7,8,9,10,11) |
| InChIKey | CJLGAEUOTQXTAB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|