About [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate
[2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate (PubChem CID 21402836) has the molecular formula C23H16BrNO5S
and a molecular weight of 498.35 g/mol. Its IUPAC name is [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate |
| PubChem CID | 21402836 |
| Molecular Formula | C23H16BrNO5S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate |
| SMILES | O=C(Nc1ccccc1OS(=O)(=O)c1cccc(Br)c1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C23H16BrNO5S/c24-17-8-5-9-18(14-17)31(28,29)30-22-11-4-3-10-20(22)25-23(27)19-12-15-6-1-2-7-16(15)13-21(19)26/h1-14,26H,(H,25,27) |
| InChIKey | QMENAUMJAWQHOS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate?
The IUPAC name of [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate (CID 21402836) is [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate.
What is the SMILES notation for [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate?
The canonical SMILES for [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate is O=C(Nc1ccccc1OS(=O)(=O)c1cccc(Br)c1)c1cc2ccccc2cc1O.
What is the InChIKey of [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate?
The InChIKey is QMENAUMJAWQHOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16BrNO5S/c24-17-8-5-9-18(14-17)31(28,29)30-22-11-4-3-10-20(22)25-23(27)19-12-15-6-1-2-7-16(15)13-21(19)26/h1-14,26H,(H,25,27).
What are the key properties of [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate?
[2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate has a molecular weight of 498.35 g/mol, XLogP of 5.33, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl] 3-bromobenzenesulfonate is sourced from PubChem (CID 21402836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).