C12H22O2 — CID 21402914
3,3,4,4,5-pentamethyl-5-propyloxolan-2-one (PubChem CID 21402914) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3,3,4,4,5-pentamethyl-5-propyloxolan-2-one.
| Compound Name | 3,3,4,4,5-pentamethyl-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 21402914 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 3,3,4,4,5-pentamethyl-5-propyloxolan-2-one |
| SMILES | CCCC1(C)OC(=O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H22O2/c1-7-8-12(6)11(4,5)10(2,3)9(13)14-12/h7-8H2,1-6H3 |
| InChIKey | KINOCHVIWJDOPD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |