About 4-hydroxypentanamide
4-hydroxypentanamide (PubChem CID 21402940) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 4-hydroxypentanamide.
Molecular Properties
| Compound Name | 4-hydroxypentanamide |
| PubChem CID | 21402940 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 4-hydroxypentanamide |
| SMILES | CC(O)CCC(N)=O |
| InChI | InChI=1S/C5H11NO2/c1-4(7)2-3-5(6)8/h4,7H,2-3H2,1H3,(H2,6,8) |
| InChIKey | FYBCSLFQRDQHAI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxypentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxypentanamide?
The IUPAC name of 4-hydroxypentanamide (CID 21402940) is 4-hydroxypentanamide.
What is the SMILES notation for 4-hydroxypentanamide?
The canonical SMILES for 4-hydroxypentanamide is CC(O)CCC(N)=O.
What is the InChIKey of 4-hydroxypentanamide?
The InChIKey is FYBCSLFQRDQHAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-4(7)2-3-5(6)8/h4,7H,2-3H2,1H3,(H2,6,8).
What are the key properties of 4-hydroxypentanamide?
4-hydroxypentanamide has a molecular weight of 117.15 g/mol, XLogP of -0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxypentanamide is sourced from PubChem (CID 21402940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).