C19H28ClNOS2 — CID 21403924
2-chloro-N-(2,6-diethylphenyl)-N-[(4,6-dimethyl-1,3-dithian-2-yl)methyl]acetamide (PubChem CID 21403924) has the molecular formula C19H28ClNOS2 and a molecular weight of 386.03 g/mol. Its IUPAC name is 2-chloro-N-(2,6-diethylphenyl)-N-[(4,6-dimethyl-1,3-dithian-2-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-(2,6-diethylphenyl)-N-[(4,6-dimethyl-1,3-dithian-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 21403924 |
| Molecular Formula | C19H28ClNOS2 |
| Molecular Weight | 386.03 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-chloro-N-(2,6-diethylphenyl)-N-[(4,6-dimethyl-1,3-dithian-2-yl)methyl]acetamide |
| SMILES | CCc1cccc(CC)c1N(CC1SC(C)CC(C)S1)C(=O)CCl |
| InChI | InChI=1S/C19H28ClNOS2/c1-5-15-8-7-9-16(6-2)19(15)21(17(22)11-20)12-18-23-13(3)10-14(4)24-18/h7-9,13-14,18H,5-6,10-12H2,1-4H3 |
| InChIKey | LDFUKWBYJXCFGI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.03 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|