About N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine
N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine (PubChem CID 21404118) has the molecular formula C4H10N4O2
and a molecular weight of 146.15 g/mol. Its IUPAC name is N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine |
| PubChem CID | 21404118 |
| Molecular Formula | C4H10N4O2 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine |
| SMILES | CNC(N=O)C(N=O)NC |
| InChI | InChI=1S/C4H10N4O2/c1-5-3(7-9)4(6-2)8-10/h3-6H,1-2H3 |
| InChIKey | TYKVHVJMPFENAF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine?
The IUPAC name of N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine (CID 21404118) is N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine.
What is the SMILES notation for N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine?
The canonical SMILES for N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine is CNC(N=O)C(N=O)NC.
What is the InChIKey of N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine?
The InChIKey is TYKVHVJMPFENAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4O2/c1-5-3(7-9)4(6-2)8-10/h3-6H,1-2H3.
What are the key properties of N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine?
N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine has a molecular weight of 146.15 g/mol, XLogP of -0.39, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-1,2-dinitrosoethane-1,2-diamine is sourced from PubChem (CID 21404118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).