C14H17NO3 — CID 2140509
ethyl 4-(2,3-dihydroindol-1-yl)-4-oxobutanoate (PubChem CID 2140509) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 4-(2,3-dihydroindol-1-yl)-4-oxobutanoate.
| Compound Name | ethyl 4-(2,3-dihydroindol-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2140509 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 4-(2,3-dihydroindol-1-yl)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H17NO3/c1-2-18-14(17)8-7-13(16)15-10-9-11-5-3-4-6-12(11)15/h3-6H,2,7-10H2,1H3 |
| InChIKey | YTMPPLAKDQKOFM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |