C9H9NO2S — CID 21405584
(2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoic acid (PubChem CID 21405584) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is (2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 21405584 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | (2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoic acid |
| SMILES | Cc1ncc(/C=C/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C9H9NO2S/c1-7-10-6-8(13-7)4-2-3-5-9(11)12/h2-6H,1H3,(H,11,12)/b4-2+,5-3+ |
| InChIKey | IUBOGANLAWIWJZ-ZUVMSYQZSA-N |
| XLogP | 2.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|