C11H13NO2S — CID 21405585
ethyl (2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoate (PubChem CID 21405585) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 21405585 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | ethyl (2E,4E)-5-(2-methyl-1,3-thiazol-5-yl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/c1cnc(C)s1 |
| InChI | InChI=1S/C11H13NO2S/c1-3-14-11(13)7-5-4-6-10-8-12-9(2)15-10/h4-8H,3H2,1-2H3/b6-4+,7-5+ |
| InChIKey | QXWRCBYYSPFYHA-YDFGWWAZSA-N |
| XLogP | 2.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|