About 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid
2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid (PubChem CID 21405675) has the molecular formula C24H23NO2
and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid |
| PubChem CID | 21405675 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid |
| SMILES | CC(C(=O)O)(c1ccccc1)C1CCN(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H23NO2/c1-24(23(26)27,18-10-4-2-5-11-18)21-16-17-25(19-12-6-3-7-13-19)22-15-9-8-14-20(21)22/h2-15,21H,16-17H2,1H3,(H,26,27) |
| InChIKey | MIMXNRTYXRVTHT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid?
The IUPAC name of 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid (CID 21405675) is 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid.
What is the SMILES notation for 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid?
The canonical SMILES for 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid is CC(C(=O)O)(c1ccccc1)C1CCN(c2ccccc2)c2ccccc21.
What is the InChIKey of 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid?
The InChIKey is MIMXNRTYXRVTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO2/c1-24(23(26)27,18-10-4-2-5-11-18)21-16-17-25(19-12-6-3-7-13-19)22-15-9-8-14-20(21)22/h2-15,21H,16-17H2,1H3,(H,26,27).
What are the key properties of 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid?
2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid has a molecular weight of 357.45 g/mol, XLogP of 5.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-(1-phenyl-3,4-dihydro-2H-quinolin-4-yl)propanoic acid is sourced from PubChem (CID 21405675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).