About 2,2-dimethyl-6,6-dipropylpiperidin-4-ol
2,2-dimethyl-6,6-dipropylpiperidin-4-ol (PubChem CID 21406085) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 2,2-dimethyl-6,6-dipropylpiperidin-4-ol.
Molecular Properties
| Compound Name | 2,2-dimethyl-6,6-dipropylpiperidin-4-ol |
| PubChem CID | 21406085 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 2,2-dimethyl-6,6-dipropylpiperidin-4-ol |
| SMILES | CCCC1(CCC)CC(O)CC(C)(C)N1 |
| InChI | InChI=1S/C13H27NO/c1-5-7-13(8-6-2)10-11(15)9-12(3,4)14-13/h11,14-15H,5-10H2,1-4H3 |
| InChIKey | SUJMGNPHMYQZMO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-6,6-dipropylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6,6-dipropylpiperidin-4-ol?
The IUPAC name of 2,2-dimethyl-6,6-dipropylpiperidin-4-ol (CID 21406085) is 2,2-dimethyl-6,6-dipropylpiperidin-4-ol.
What is the SMILES notation for 2,2-dimethyl-6,6-dipropylpiperidin-4-ol?
The canonical SMILES for 2,2-dimethyl-6,6-dipropylpiperidin-4-ol is CCCC1(CCC)CC(O)CC(C)(C)N1.
What is the InChIKey of 2,2-dimethyl-6,6-dipropylpiperidin-4-ol?
The InChIKey is SUJMGNPHMYQZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-5-7-13(8-6-2)10-11(15)9-12(3,4)14-13/h11,14-15H,5-10H2,1-4H3.
What are the key properties of 2,2-dimethyl-6,6-dipropylpiperidin-4-ol?
2,2-dimethyl-6,6-dipropylpiperidin-4-ol has a molecular weight of 213.36 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6,6-dipropylpiperidin-4-ol is sourced from PubChem (CID 21406085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).