C11H12BrN3O — CID 21406183
1-(4-bromophenyl)-3-(3,4-dihydro-2H-pyrrol-5-yl)urea (PubChem CID 21406183) has the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(3,4-dihydro-2H-pyrrol-5-yl)urea.
| Compound Name | 1-(4-bromophenyl)-3-(3,4-dihydro-2H-pyrrol-5-yl)urea |
|---|---|
| PubChem CID | 21406183 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 1-(4-bromophenyl)-3-(3,4-dihydro-2H-pyrrol-5-yl)urea |
| SMILES | O=C(NC1=NCCC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrN3O/c12-8-3-5-9(6-4-8)14-11(16)15-10-2-1-7-13-10/h3-6H,1-2,7H2,(H2,13,14,15,16) |
| InChIKey | XXKPVGOYBYONRU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |