2-methoxy-3-nitrobenzoyl chloride

C8H6ClNO4 — CID 21406531

IUPAC2-methoxy-3-nitrobenzoyl chloride
SMILESCOc1c(C(=O)Cl)cccc1[N+](=O)[O-]
InChIInChI=1S/C8H6ClNO4/c1-14-7-5(8(9)11)3-2-4-6(7)10(12)13/h2-4H,1H3
InChIKeyCDOHOBATACGOMT-UHFFFAOYSA-N
MW215.59 g/mol
LogP1.98
Rot. Bonds3

About 2-methoxy-3-nitrobenzoyl chloride

2-methoxy-3-nitrobenzoyl chloride (PubChem CID 21406531) has the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. Its IUPAC name is 2-methoxy-3-nitrobenzoyl chloride.

Molecular Properties

Compound Name2-methoxy-3-nitrobenzoyl chloride
PubChem CID21406531
Molecular FormulaC8H6ClNO4
Molecular Weight215.59 g/mol
Exact Mass215.00
IUPAC Name2-methoxy-3-nitrobenzoyl chloride
SMILESCOc1c(C(=O)Cl)cccc1[N+](=O)[O-]
InChIInChI=1S/C8H6ClNO4/c1-14-7-5(8(9)11)3-2-4-6(7)10(12)13/h2-4H,1H3
InChIKeyCDOHOBATACGOMT-UHFFFAOYSA-N
XLogP1.98
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.59
LogP ≤ 51.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-methoxy-3-nitrobenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxy-3-nitrobenzoyl chloride?
The IUPAC name of 2-methoxy-3-nitrobenzoyl chloride (CID 21406531) is 2-methoxy-3-nitrobenzoyl chloride.
What is the SMILES notation for 2-methoxy-3-nitrobenzoyl chloride?
The canonical SMILES for 2-methoxy-3-nitrobenzoyl chloride is COc1c(C(=O)Cl)cccc1[N+](=O)[O-].
What is the InChIKey of 2-methoxy-3-nitrobenzoyl chloride?
The InChIKey is CDOHOBATACGOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO4/c1-14-7-5(8(9)11)3-2-4-6(7)10(12)13/h2-4H,1H3.
What are the key properties of 2-methoxy-3-nitrobenzoyl chloride?
2-methoxy-3-nitrobenzoyl chloride has a molecular weight of 215.59 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-nitrobenzoyl chloride is sourced from PubChem (CID 21406531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).