About 2-methoxy-3-nitrobenzoyl chloride
2-methoxy-3-nitrobenzoyl chloride (PubChem CID 21406531) has the molecular formula C8H6ClNO4
and a molecular weight of 215.59 g/mol. Its IUPAC name is 2-methoxy-3-nitrobenzoyl chloride.
Molecular Properties
| Compound Name | 2-methoxy-3-nitrobenzoyl chloride |
| PubChem CID | 21406531 |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.59 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | 2-methoxy-3-nitrobenzoyl chloride |
| SMILES | COc1c(C(=O)Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6ClNO4/c1-14-7-5(8(9)11)3-2-4-6(7)10(12)13/h2-4H,1H3 |
| InChIKey | CDOHOBATACGOMT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.59 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3-nitrobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-nitrobenzoyl chloride?
The IUPAC name of 2-methoxy-3-nitrobenzoyl chloride (CID 21406531) is 2-methoxy-3-nitrobenzoyl chloride.
What is the SMILES notation for 2-methoxy-3-nitrobenzoyl chloride?
The canonical SMILES for 2-methoxy-3-nitrobenzoyl chloride is COc1c(C(=O)Cl)cccc1[N+](=O)[O-].
What is the InChIKey of 2-methoxy-3-nitrobenzoyl chloride?
The InChIKey is CDOHOBATACGOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO4/c1-14-7-5(8(9)11)3-2-4-6(7)10(12)13/h2-4H,1H3.
What are the key properties of 2-methoxy-3-nitrobenzoyl chloride?
2-methoxy-3-nitrobenzoyl chloride has a molecular weight of 215.59 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-nitrobenzoyl chloride is sourced from PubChem (CID 21406531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).