C11H11BrCl4O — CID 21406976
2-(3-bromo-5-methylphenyl)-1,4,4,4-tetrachlorobutan-2-ol (PubChem CID 21406976) has the molecular formula C11H11BrCl4O and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-(3-bromo-5-methylphenyl)-1,4,4,4-tetrachlorobutan-2-ol.
| Compound Name | 2-(3-bromo-5-methylphenyl)-1,4,4,4-tetrachlorobutan-2-ol |
|---|---|
| PubChem CID | 21406976 |
| Molecular Formula | C11H11BrCl4O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 377.87 |
| IUPAC Name | 2-(3-bromo-5-methylphenyl)-1,4,4,4-tetrachlorobutan-2-ol |
| SMILES | Cc1cc(Br)cc(C(O)(CCl)CC(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C11H11BrCl4O/c1-7-2-8(4-9(12)3-7)10(17,6-13)5-11(14,15)16/h2-4,17H,5-6H2,1H3 |
| InChIKey | PFKDNGRIHPGVPT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|