About Lauryl hexaoxyethylene
Lauryl hexaoxyethylene (PubChem CID 21407036) has the molecular formula C20H40O
and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-hexoxytetradec-1-ene.
Molecular Properties
| Compound Name | Lauryl hexaoxyethylene |
| PubChem CID | 21407036 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 2-hexoxytetradec-1-ene |
| SMILES | CCCCCCCCCCCCC(=C)OCCCCCC |
| InChI | InChI=1S/C20H40O/c1-4-6-8-10-11-12-13-14-15-16-18-20(3)21-19-17-9-7-5-2/h3-19H2,1-2H3 |
| InChIKey | ZPGXRXCGXVAGAO-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | 210 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Lauryl hexaoxyethylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lauryl hexaoxyethylene?
The IUPAC name of Lauryl hexaoxyethylene (CID 21407036) is 2-hexoxytetradec-1-ene.
What is the SMILES notation for Lauryl hexaoxyethylene?
The canonical SMILES for Lauryl hexaoxyethylene is CCCCCCCCCCCCC(=C)OCCCCCC.
What is the InChIKey of Lauryl hexaoxyethylene?
The InChIKey is ZPGXRXCGXVAGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O/c1-4-6-8-10-11-12-13-14-15-16-18-20(3)21-19-17-9-7-5-2/h3-19H2,1-2H3.
What are the key properties of Lauryl hexaoxyethylene?
Lauryl hexaoxyethylene has a molecular weight of 296.50 g/mol, XLogP of 9.20, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Lauryl hexaoxyethylene is sourced from PubChem (CID 21407036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).