C5H14N2O4 — CID 21407054
1-N,1-N,3-N,3-N-tetrahydroxypentane-1,3-diamine (PubChem CID 21407054) has the molecular formula C5H14N2O4 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrahydroxypentane-1,3-diamine.
| Compound Name | 1-N,1-N,3-N,3-N-tetrahydroxypentane-1,3-diamine |
|---|---|
| PubChem CID | 21407054 |
| Molecular Formula | C5H14N2O4 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrahydroxypentane-1,3-diamine |
| SMILES | CCC(CCN(O)O)N(O)O |
| InChI | InChI=1S/C5H14N2O4/c1-2-5(7(10)11)3-4-6(8)9/h5,8-11H,2-4H2,1H3 |
| InChIKey | GNFBBHWTISVVQD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|