About 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one
6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one (PubChem CID 21407123) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one.
Molecular Properties
| Compound Name | 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one |
| PubChem CID | 21407123 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one |
| SMILES | CCOC1CC2C(=O)CC(C)(C)C12C |
| InChI | InChI=1S/C12H20O2/c1-5-14-10-6-8-9(13)7-11(2,3)12(8,10)4/h8,10H,5-7H2,1-4H3 |
| InChIKey | MGKBYJUDHHGZTH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one?
The IUPAC name of 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one (CID 21407123) is 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one.
What is the SMILES notation for 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one?
The canonical SMILES for 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one is CCOC1CC2C(=O)CC(C)(C)C12C.
What is the InChIKey of 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one?
The InChIKey is MGKBYJUDHHGZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-5-14-10-6-8-9(13)7-11(2,3)12(8,10)4/h8,10H,5-7H2,1-4H3.
What are the key properties of 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one?
6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one has a molecular weight of 196.29 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-4,4,5-trimethylbicyclo[3.2.0]heptan-2-one is sourced from PubChem (CID 21407123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).