C8H6Br4Cl2N2S — CID 21407555
[amino-[(2,4,6-tribromo-3,5-dichlorophenyl)methylsulfanyl]methylidene]azanium bromide (PubChem CID 21407555) has the molecular formula C8H6Br4Cl2N2S and a molecular weight of 552.74 g/mol. Its IUPAC name is [amino-[(2,4,6-tribromo-3,5-dichlorophenyl)methylsulfanyl]methylidene]azanium bromide.
| Compound Name | [amino-[(2,4,6-tribromo-3,5-dichlorophenyl)methylsulfanyl]methylidene]azanium bromide |
|---|---|
| PubChem CID | 21407555 |
| Molecular Formula | C8H6Br4Cl2N2S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 547.64 |
| IUPAC Name | [amino-[(2,4,6-tribromo-3,5-dichlorophenyl)methylsulfanyl]methylidene]azanium bromide |
| SMILES | NC(=[NH2+])SCc1c(Br)c(Cl)c(Br)c(Cl)c1Br.[Br-] |
| InChI | InChI=1S/C8H5Br3Cl2N2S.BrH/c9-3-2(1-16-8(14)15)4(10)7(13)5(11)6(3)12;/h1H2,(H3,14,15);1H |
| InChIKey | LZHOISHJWAPHGR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|