About [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate
[2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate (PubChem CID 21408045) has the molecular formula C26H27NO3
and a molecular weight of 401.51 g/mol. Its IUPAC name is [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate.
Molecular Properties
| Compound Name | [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate |
| PubChem CID | 21408045 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate |
| SMILES | CC(=O)OCC(Oc1ccc(C2CCN(C)c3ccccc32)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO3/c1-19(28)29-18-26(21-8-4-3-5-9-21)30-22-14-12-20(13-15-22)23-16-17-27(2)25-11-7-6-10-24(23)25/h3-15,23,26H,16-18H2,1-2H3 |
| InChIKey | YFABNELOKJFEPT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate?
The IUPAC name of [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate (CID 21408045) is [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate.
What is the SMILES notation for [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate?
The canonical SMILES for [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate is CC(=O)OCC(Oc1ccc(C2CCN(C)c3ccccc32)cc1)c1ccccc1.
What is the InChIKey of [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate?
The InChIKey is YFABNELOKJFEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO3/c1-19(28)29-18-26(21-8-4-3-5-9-21)30-22-14-12-20(13-15-22)23-16-17-27(2)25-11-7-6-10-24(23)25/h3-15,23,26H,16-18H2,1-2H3.
What are the key properties of [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate?
[2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate has a molecular weight of 401.51 g/mol, XLogP of 5.34, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)phenoxy]-2-phenylethyl] acetate is sourced from PubChem (CID 21408045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).