About 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol
4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol (PubChem CID 21408454) has the molecular formula C19H21NO2S
and a molecular weight of 327.45 g/mol. Its IUPAC name is 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol.
Molecular Properties
| Compound Name | 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol |
| PubChem CID | 21408454 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol |
| SMILES | Cc1ccc(-c2ncoc2-c2ccc(C)cc2)cc1.OCCS |
| InChI | InChI=1S/C17H15NO.C2H6OS/c1-12-3-7-14(8-4-12)16-17(19-11-18-16)15-9-5-13(2)6-10-15;3-1-2-4/h3-11H,1-2H3;3-4H,1-2H2 |
| InChIKey | DDFIQLVMUTZULL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol?
The IUPAC name of 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol (CID 21408454) is 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol.
What is the SMILES notation for 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol?
The canonical SMILES for 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol is Cc1ccc(-c2ncoc2-c2ccc(C)cc2)cc1.OCCS.
What is the InChIKey of 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol?
The InChIKey is DDFIQLVMUTZULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO.C2H6OS/c1-12-3-7-14(8-4-12)16-17(19-11-18-16)15-9-5-13(2)6-10-15;3-1-2-4/h3-11H,1-2H3;3-4H,1-2H2.
What are the key properties of 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol?
4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol has a molecular weight of 327.45 g/mol, XLogP of 4.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(4-methylphenyl)-1,3-oxazole;2-sulfanylethanol is sourced from PubChem (CID 21408454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).